![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 16 - Where Is My Mind.mp3 | 2002-05-28 15:27 | 5.3M | |
| 18 - (Free To Do Anything).mp3 | 2002-05-28 15:27 | 80K | |
| 04 - single serving jack.mp3 | 2002-05-28 15:28 | 5.8M | |
| 02 - Fight Club - Fight Club Rules.mp3 | 2002-05-28 15:28 | 784K | |
| 00 - who is tyler durden.mp3 | 2002-05-28 15:28 | 6.9M | |
| 01 - homework.mp3 | 2002-05-28 15:28 | 6.3M | |
| 03 - what is fight club.mp3 | 2002-05-28 15:28 | 6.5M | |
| 05 - corporate world.mp3 | 2002-05-28 15:29 | 3.7M | |
| 06 - psycho boy jack.mp3 | 2002-05-28 15:29 | 4.1M | |
| 07 - Hessel, Raymond K.mp3 | 2002-05-28 15:29 | 3.9M | |
| 08 - medula oblongata.mp3 | 2002-05-28 15:29 | 8.2M | |
| 09 - jack's smirking revenge.mp3 | 2002-05-28 15:29 | 5.5M | |
| 10 - stealing fat.mp3 | 2002-05-28 15:29 | 3.2M | |
| 11 - chemical burn.mp3 | 2002-05-28 15:29 | 4.9M | |
| 12 - Marla.mp3 | 2002-05-28 15:29 | 6.0M | |
| 13 - commissioner castration.mp3 | 2002-05-28 15:29 | 4.3M | |
| 14 - space monkeys.mp3 | 2002-05-28 15:29 | 4.7M | |
| 15 - finding the bomb.mp3 | 2002-05-28 15:29 | 9.3M | |
| 17 - This Is Your Life.mp3 | 2002-05-28 15:30 | 4.0M | |