![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 3 Doors Down Away From The Sun/ | 2016-12-11 15:50 | - | |
| Beastie Boys/ | 2024-12-15 22:48 | - | |
| Bittersweet/ | 2024-12-15 22:49 | - | |
| Bloodhound Gang/ | 2024-12-15 22:49 | - | |
| Clan of Xymox/ | 2024-12-15 22:50 | - | |
| Deftones - White Pony/ | 2024-12-15 22:51 | - | |
| Die Happy/ | 2024-12-15 22:52 | - | |
| Dr. Ring-Ding/ | 2024-12-15 22:53 | - | |
| Evanescence/ | 2024-12-15 22:54 | - | |
| Godsmack - Awake/ | 2024-12-15 22:54 | - | |
| Incubus/ | 2024-12-15 22:56 | - | |
| Massive Attack/ | 2024-12-15 22:59 | - | |
| Metallica/ | 2024-12-15 22:59 | - | |
| Ozzy Osbourne/ | 2024-12-15 22:59 | - | |
| P.O.D - Satellite/ | 2016-12-11 15:52 | - | |
| Portsihead/ | 2024-12-15 23:02 | - | |
| Prodigy/ | 2024-12-15 23:03 | - | |
| Rammstein/ | 2024-12-15 23:13 | - | |
| Sisters of mercy/ | 2024-12-15 23:14 | - | |
| Smashing Pumpkins/ | 2024-12-15 23:14 | - | |
| Sneaker Pimps/ | 2024-12-15 23:18 | - | |
| The Chemical Brothers/ | 2024-12-15 23:23 | - | |
| The Smashing Pumpkins/ | 2024-12-15 23:34 | - | |
| Tom Petty & The Heartbreakers/ | 2024-12-15 23:35 | - | |
| Tricky/ | 2024-12-15 23:43 | - | |
| Type O' Negative/ | 2024-12-15 23:43 | - | |
| aphex twin/ | 2024-12-15 22:46 | - | |
| bush/ | 2016-12-11 15:51 | - | |
| doors - break on through.mp3 | 2001-02-02 23:24 | 2.2M | |
| hed pe/ | 2016-12-11 15:51 | - | |
| limp bisquit/ | 2024-12-15 22:56 | - | |
| papa roach - last resort (clean).mp3 | 2001-02-21 23:55 | 3.1M | |
| pitchshifter/ | 2016-12-11 15:52 | - | |