![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01-this life.mp3 | 2005-07-20 15:54 | 6.8M | |
| 02-shame.mp3 | 2005-07-20 15:55 | 3.4M | |
| 03-who the fuck.mp3 | 2005-07-20 15:55 | 3.2M | |
| 04-polket knife.mp3 | 2005-07-20 15:56 | 5.2M | |
| 05-the letter.mp3 | 2005-07-20 15:57 | 4.8M | |
| 06-the slow drug.mp3 | 2005-07-20 15:57 | 4.7M | |
| 07-no child of mine.mp3 | 2005-07-20 15:58 | 1.5M | |
| 08-cat on the wind.mp3 | 2005-07-20 15:59 | 4.4M | |
| 09-the radio.mp3 | 2005-07-20 16:00 | 3.6M | |
| 10-you come through.mp3 | 2005-07-20 16:01 | 5.9M | |
| 11-its you.mp3 | 2005-07-20 16:01 | 1.7M | |
| 12-the end.mp3 | 2005-07-20 16:02 | 3.5M | |
| 13-the desperate kingdom of love.mp3 | 2005-07-20 16:02 | 1.7M | |
| 14-the darker days.mp3 | 2005-07-20 16:02 | 6.1M | |